C22H35N3O2S — CID 3867230
2-(5-hydroxy-2,4,8a-trimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl)-1-(4-methylpiperazin-1-yl)propan-1-one (PubChem CID 3867230) has the molecular formula C22H35N3O2S and a molecular weight of 405.61 g/mol. Its IUPAC name is 2-(5-hydroxy-2,4,8a-trimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl)-1-(4-methylpiperazin-1-yl)propan-1-one.
| Compound Name | 2-(5-hydroxy-2,4,8a-trimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl)-1-(4-methylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 3867230 |
| Molecular Formula | C22H35N3O2S |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 2-(5-hydroxy-2,4,8a-trimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl)-1-(4-methylpiperazin-1-yl)propan-1-one |
| SMILES | Cc1nc2c(s1)CC1(C)CCC(C(C)C(=O)N3CCN(C)CC3)C(O)C1C2C |
| InChI | InChI=1S/C22H35N3O2S/c1-13(21(27)25-10-8-24(5)9-11-25)16-6-7-22(4)12-17-19(23-15(3)28-17)14(2)18(22)20(16)26/h13-14,16,18,20,26H,6-12H2,1-5H3 |
| InChIKey | WFVUWTNDBYLXCG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |