About ethyl 1-(7-methylimidazo[1,2-a]pyridine-2-carbonyl)piperidine-4-carboxylate
ethyl 1-(7-methylimidazo[1,2-a]pyridine-2-carbonyl)piperidine-4-carboxylate (PubChem CID 34421493) has the molecular formula C17H21N3O3
and a molecular weight of 315.37 g/mol. Its IUPAC name is ethyl 1-(7-methylimidazo[1,2-a]pyridine-2-carbonyl)piperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(7-methylimidazo[1,2-a]pyridine-2-carbonyl)piperidine-4-carboxylate |
| PubChem CID | 34421493 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | ethyl 1-(7-methylimidazo[1,2-a]pyridine-2-carbonyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2cn3ccc(C)cc3n2)CC1 |
| InChI | InChI=1S/C17H21N3O3/c1-3-23-17(22)13-5-8-19(9-6-13)16(21)14-11-20-7-4-12(2)10-15(20)18-14/h4,7,10-11,13H,3,5-6,8-9H2,1-2H3 |
| InChIKey | UKQZHXZVKYSWPR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 1-(7-methylimidazo[1,2-a]pyridine-2-carbonyl)piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(7-methylimidazo[1,2-a]pyridine-2-carbonyl)piperidine-4-carboxylate?
The IUPAC name of ethyl 1-(7-methylimidazo[1,2-a]pyridine-2-carbonyl)piperidine-4-carboxylate (CID 34421493) is ethyl 1-(7-methylimidazo[1,2-a]pyridine-2-carbonyl)piperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-(7-methylimidazo[1,2-a]pyridine-2-carbonyl)piperidine-4-carboxylate?
The canonical SMILES for ethyl 1-(7-methylimidazo[1,2-a]pyridine-2-carbonyl)piperidine-4-carboxylate is CCOC(=O)C1CCN(C(=O)c2cn3ccc(C)cc3n2)CC1.
What is the InChIKey of ethyl 1-(7-methylimidazo[1,2-a]pyridine-2-carbonyl)piperidine-4-carboxylate?
The InChIKey is UKQZHXZVKYSWPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O3/c1-3-23-17(22)13-5-8-19(9-6-13)16(21)14-11-20-7-4-12(2)10-15(20)18-14/h4,7,10-11,13H,3,5-6,8-9H2,1-2H3.
What are the key properties of ethyl 1-(7-methylimidazo[1,2-a]pyridine-2-carbonyl)piperidine-4-carboxylate?
ethyl 1-(7-methylimidazo[1,2-a]pyridine-2-carbonyl)piperidine-4-carboxylate has a molecular weight of 315.37 g/mol, XLogP of 2.06, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(7-methylimidazo[1,2-a]pyridine-2-carbonyl)piperidine-4-carboxylate is sourced from PubChem (CID 34421493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).