C26H34N4OS — CID 3448657
N-[1-[4-(4-methylphenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]ethyl]heptanamide (PubChem CID 3448657) has the molecular formula C26H34N4OS and a molecular weight of 450.65 g/mol. Its IUPAC name is N-[1-[4-(4-methylphenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]ethyl]heptanamide.
| Compound Name | N-[1-[4-(4-methylphenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]ethyl]heptanamide |
|---|---|
| PubChem CID | 3448657 |
| Molecular Formula | C26H34N4OS |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | N-[1-[4-(4-methylphenyl)-5-[(3-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]ethyl]heptanamide |
| SMILES | CCCCCCC(=O)NC(C)c1nnc(SCc2cccc(C)c2)n1-c1ccc(C)cc1 |
| InChI | InChI=1S/C26H34N4OS/c1-5-6-7-8-12-24(31)27-21(4)25-28-29-26(30(25)23-15-13-19(2)14-16-23)32-18-22-11-9-10-20(3)17-22/h9-11,13-17,21H,5-8,12,18H2,1-4H3,(H,27,31) |
| InChIKey | APQPMTZPUVPTCB-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|