C18H17Cl2N5O2 — CID 3451084
4-amino-N-[(2,4-dichlorophenyl)methoxy]-N'-(2,4-dimethylphenyl)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 3451084) has the molecular formula C18H17Cl2N5O2 and a molecular weight of 406.27 g/mol. Its IUPAC name is 4-amino-N-[(2,4-dichlorophenyl)methoxy]-N'-(2,4-dimethylphenyl)-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-amino-N-[(2,4-dichlorophenyl)methoxy]-N'-(2,4-dimethylphenyl)-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 3451084 |
| Molecular Formula | C18H17Cl2N5O2 |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 4-amino-N-[(2,4-dichlorophenyl)methoxy]-N'-(2,4-dimethylphenyl)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | Cc1ccc(/N=C(\NOCc2ccc(Cl)cc2Cl)c2nonc2N)c(C)c1 |
| InChI | InChI=1S/C18H17Cl2N5O2/c1-10-3-6-15(11(2)7-10)22-18(16-17(21)24-27-23-16)25-26-9-12-4-5-13(19)8-14(12)20/h3-8H,9H2,1-2H3,(H2,21,24)(H,22,25) |
| InChIKey | OHUNCUXJHFATEQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|