C17H16Cl2N5O2+ — CID 6343063
[(4-amino-1,2,5-oxadiazol-3-yl)-[(2,4-dichlorophenyl)methoxyamino]methylidene]-benzylazanium (PubChem CID 6343063) has the molecular formula C17H16Cl2N5O2+ and a molecular weight of 393.25 g/mol. Its IUPAC name is [(4-amino-1,2,5-oxadiazol-3-yl)-[(2,4-dichlorophenyl)methoxyamino]methylidene]-benzylazanium.
| Compound Name | [(4-amino-1,2,5-oxadiazol-3-yl)-[(2,4-dichlorophenyl)methoxyamino]methylidene]-benzylazanium |
|---|---|
| PubChem CID | 6343063 |
| Molecular Formula | C17H16Cl2N5O2+ |
| Molecular Weight | 393.25 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | [(4-amino-1,2,5-oxadiazol-3-yl)-[(2,4-dichlorophenyl)methoxyamino]methylidene]-benzylazanium |
| SMILES | Nc1nonc1/C(NOCc1ccc(Cl)cc1Cl)=[NH+]/Cc1ccccc1 |
| InChI | InChI=1S/C17H15Cl2N5O2/c18-13-7-6-12(14(19)8-13)10-25-24-17(15-16(20)23-26-22-15)21-9-11-4-2-1-3-5-11/h1-8H,9-10H2,(H2,20,23)(H,21,24)/p+1 |
| InChIKey | FQGDWAZXZGAQSP-UHFFFAOYSA-O |
| XLogP | 1.71 |
| TPSA | 100.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|