C11H11NO2 — CID 3456444
2-[(4,5-dimethylfuran-2-yl)methylidene]-3-oxobutanenitrile (PubChem CID 3456444) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 2-[(4,5-dimethylfuran-2-yl)methylidene]-3-oxobutanenitrile.
| Compound Name | 2-[(4,5-dimethylfuran-2-yl)methylidene]-3-oxobutanenitrile |
|---|---|
| PubChem CID | 3456444 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 2-[(4,5-dimethylfuran-2-yl)methylidene]-3-oxobutanenitrile |
| SMILES | CC(=O)C(C#N)=Cc1cc(C)c(C)o1 |
| InChI | InChI=1S/C11H11NO2/c1-7-4-11(14-9(7)3)5-10(6-12)8(2)13/h4-5H,1-3H3 |
| InChIKey | ZKVHKJBPZPHKPO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 54.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|