C34H44N2O4 — CID 3480833
2-nonyl-6-(2-nonyl-4-oxo-3,1-benzoxazin-6-yl)-3,1-benzoxazin-4-one (PubChem CID 3480833) has the molecular formula C34H44N2O4 and a molecular weight of 544.74 g/mol. Its IUPAC name is 2-nonyl-6-(2-nonyl-4-oxo-3,1-benzoxazin-6-yl)-3,1-benzoxazin-4-one.
| Compound Name | 2-nonyl-6-(2-nonyl-4-oxo-3,1-benzoxazin-6-yl)-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 3480833 |
| Molecular Formula | C34H44N2O4 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | 2-nonyl-6-(2-nonyl-4-oxo-3,1-benzoxazin-6-yl)-3,1-benzoxazin-4-one |
| SMILES | CCCCCCCCCc1nc2ccc(-c3ccc4nc(CCCCCCCCC)oc(=O)c4c3)cc2c(=O)o1 |
| InChI | InChI=1S/C34H44N2O4/c1-3-5-7-9-11-13-15-17-31-35-29-21-19-25(23-27(29)33(37)39-31)26-20-22-30-28(24-26)34(38)40-32(36-30)18-16-14-12-10-8-6-4-2/h19-24H,3-18H2,1-2H3 |
| InChIKey | ODENFJLIAJBQAR-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 86.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|