C26H29ClFN3O2 — CID 34820503
(E)-1-[4-[4-[(2-chloro-4-fluorophenyl)methyl]piperazine-1-carbonyl]piperidin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 34820503) has the molecular formula C26H29ClFN3O2 and a molecular weight of 469.99 g/mol. Its IUPAC name is (E)-1-[4-[4-[(2-chloro-4-fluorophenyl)methyl]piperazine-1-carbonyl]piperidin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[4-[4-[(2-chloro-4-fluorophenyl)methyl]piperazine-1-carbonyl]piperidin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 34820503 |
| Molecular Formula | C26H29ClFN3O2 |
| Molecular Weight | 469.99 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | (E)-1-[4-[4-[(2-chloro-4-fluorophenyl)methyl]piperazine-1-carbonyl]piperidin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)N1CCC(C(=O)N2CCN(Cc3ccc(F)cc3Cl)CC2)CC1 |
| InChI | InChI=1S/C26H29ClFN3O2/c27-24-18-23(28)8-7-22(24)19-29-14-16-31(17-15-29)26(33)21-10-12-30(13-11-21)25(32)9-6-20-4-2-1-3-5-20/h1-9,18,21H,10-17,19H2/b9-6+ |
| InChIKey | OBNVPCIZSRRQQA-RMKNXTFCSA-N |
| XLogP | 4.08 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.99 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|