C19H19ClFN3O — CID 34823435
(E)-1-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-3-pyridin-3-ylprop-2-en-1-one (PubChem CID 34823435) has the molecular formula C19H19ClFN3O and a molecular weight of 359.83 g/mol. Its IUPAC name is (E)-1-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-3-pyridin-3-ylprop-2-en-1-one.
| Compound Name | (E)-1-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-3-pyridin-3-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 34823435 |
| Molecular Formula | C19H19ClFN3O |
| Molecular Weight | 359.83 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | (E)-1-[4-[(2-chloro-4-fluorophenyl)methyl]piperazin-1-yl]-3-pyridin-3-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccnc1)N1CCN(Cc2ccc(F)cc2Cl)CC1 |
| InChI | InChI=1S/C19H19ClFN3O/c20-18-12-17(21)5-4-16(18)14-23-8-10-24(11-9-23)19(25)6-3-15-2-1-7-22-13-15/h1-7,12-13H,8-11,14H2/b6-3+ |
| InChIKey | AZQLIULNAOJSJU-ZZXKWVIFSA-N |
| XLogP | 3.23 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.83 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|