C21H18BrN3O6S — CID 3484468
N-[2-[(6-bromo-2-methoxynaphthalen-1-yl)methylsulfanyl]ethyl]-3,5-dinitrobenzamide (PubChem CID 3484468) has the molecular formula C21H18BrN3O6S and a molecular weight of 520.36 g/mol. Its IUPAC name is N-[2-[(6-bromo-2-methoxynaphthalen-1-yl)methylsulfanyl]ethyl]-3,5-dinitrobenzamide.
| Compound Name | N-[2-[(6-bromo-2-methoxynaphthalen-1-yl)methylsulfanyl]ethyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 3484468 |
| Molecular Formula | C21H18BrN3O6S |
| Molecular Weight | 520.36 g/mol |
| Exact Mass | 519.01 |
| IUPAC Name | N-[2-[(6-bromo-2-methoxynaphthalen-1-yl)methylsulfanyl]ethyl]-3,5-dinitrobenzamide |
| SMILES | COc1ccc2cc(Br)ccc2c1CSCCNC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H18BrN3O6S/c1-31-20-5-2-13-8-15(22)3-4-18(13)19(20)12-32-7-6-23-21(26)14-9-16(24(27)28)11-17(10-14)25(29)30/h2-5,8-11H,6-7,12H2,1H3,(H,23,26) |
| InChIKey | YVLFTCDAOOXISL-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.36 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|