C21H19Br2NO2S — CID 3484465
4-bromo-N-[2-[(6-bromo-2-methoxynaphthalen-1-yl)methylsulfanyl]ethyl]benzamide (PubChem CID 3484465) has the molecular formula C21H19Br2NO2S and a molecular weight of 509.26 g/mol. Its IUPAC name is 4-bromo-N-[2-[(6-bromo-2-methoxynaphthalen-1-yl)methylsulfanyl]ethyl]benzamide.
| Compound Name | 4-bromo-N-[2-[(6-bromo-2-methoxynaphthalen-1-yl)methylsulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 3484465 |
| Molecular Formula | C21H19Br2NO2S |
| Molecular Weight | 509.26 g/mol |
| Exact Mass | 506.95 |
| IUPAC Name | 4-bromo-N-[2-[(6-bromo-2-methoxynaphthalen-1-yl)methylsulfanyl]ethyl]benzamide |
| SMILES | COc1ccc2cc(Br)ccc2c1CSCCNC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H19Br2NO2S/c1-26-20-9-4-15-12-17(23)7-8-18(15)19(20)13-27-11-10-24-21(25)14-2-5-16(22)6-3-14/h2-9,12H,10-11,13H2,1H3,(H,24,25) |
| InChIKey | FQRVJVKYBIPHEX-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.26 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|