C21H17ClN2OS2 — CID 3486734
5-(4-chlorophenyl)-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)furan-2-carbothioamide (PubChem CID 3486734) has the molecular formula C21H17ClN2OS2 and a molecular weight of 412.97 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)furan-2-carbothioamide.
| Compound Name | 5-(4-chlorophenyl)-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)furan-2-carbothioamide |
|---|---|
| PubChem CID | 3486734 |
| Molecular Formula | C21H17ClN2OS2 |
| Molecular Weight | 412.97 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)furan-2-carbothioamide |
| SMILES | CC1CCc2c(sc(NC(=S)c3ccc(-c4ccc(Cl)cc4)o3)c2C#N)C1 |
| InChI | InChI=1S/C21H17ClN2OS2/c1-12-2-7-15-16(11-23)21(27-19(15)10-12)24-20(26)18-9-8-17(25-18)13-3-5-14(22)6-4-13/h3-6,8-9,12H,2,7,10H2,1H3,(H,24,26) |
| InChIKey | DPWYJGNCBFKBIH-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 48.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.97 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|