C25H26FN5O2S — CID 3509717
2-[[4-(2-fluorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-N-hexyl-1,3-oxazole-4-carboxamide (PubChem CID 3509717) has the molecular formula C25H26FN5O2S and a molecular weight of 479.58 g/mol. Its IUPAC name is 2-[[4-(2-fluorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-N-hexyl-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[[4-(2-fluorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-N-hexyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3509717 |
| Molecular Formula | C25H26FN5O2S |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 2-[[4-(2-fluorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-N-hexyl-1,3-oxazole-4-carboxamide |
| SMILES | CCCCCCNC(=O)c1coc(CSc2nnc(-c3ccccc3)n2-c2ccccc2F)n1 |
| InChI | InChI=1S/C25H26FN5O2S/c1-2-3-4-10-15-27-24(32)20-16-33-22(28-20)17-34-25-30-29-23(18-11-6-5-7-12-18)31(25)21-14-9-8-13-19(21)26/h5-9,11-14,16H,2-4,10,15,17H2,1H3,(H,27,32) |
| InChIKey | AEVSWVCLUIIDCS-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|