C10H6F3N5O3 — CID 3516420
4-[(3-nitrophenyl)diazenyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one (PubChem CID 3516420) has the molecular formula C10H6F3N5O3 and a molecular weight of 301.18 g/mol. Its IUPAC name is 4-[(3-nitrophenyl)diazenyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one.
| Compound Name | 4-[(3-nitrophenyl)diazenyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 3516420 |
| Molecular Formula | C10H6F3N5O3 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 4-[(3-nitrophenyl)diazenyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one |
| SMILES | O=c1[nH][nH]c(C(F)(F)F)c1/N=N/c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H6F3N5O3/c11-10(12,13)8-7(9(19)17-16-8)15-14-5-2-1-3-6(4-5)18(20)21/h1-4H,(H2,16,17,19)/b15-14+ |
| InChIKey | KWWBVPCUKDSQEJ-CCEZHUSRSA-N |
| XLogP | 3.05 |
| TPSA | 116.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|