C21H23F3N3O3+ — CID 3519641
2-[4-[3-(furan-2-yl)prop-2-enoyl]-1-methylpiperazin-1-ium-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 3519641) has the molecular formula C21H23F3N3O3+ and a molecular weight of 422.43 g/mol. Its IUPAC name is 2-[4-[3-(furan-2-yl)prop-2-enoyl]-1-methylpiperazin-1-ium-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-[3-(furan-2-yl)prop-2-enoyl]-1-methylpiperazin-1-ium-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 3519641 |
| Molecular Formula | C21H23F3N3O3+ |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 2-[4-[3-(furan-2-yl)prop-2-enoyl]-1-methylpiperazin-1-ium-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | C[N+]1(CC(=O)Nc2cccc(C(F)(F)F)c2)CCN(C(=O)C=Cc2ccco2)CC1 |
| InChI | InChI=1S/C21H22F3N3O3/c1-27(15-19(28)25-17-5-2-4-16(14-17)21(22,23)24)11-9-26(10-12-27)20(29)8-7-18-6-3-13-30-18/h2-8,13-14H,9-12,15H2,1H3/p+1 |
| InChIKey | PPRAVZNFYCRFGD-UHFFFAOYSA-O |
| XLogP | 3.24 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|