C21H25F3N2O2 — CID 35245114
1-(4-methoxyphenyl)-2,5-dimethyl-N-[(1R,2S)-2-(trifluoromethyl)cyclohexyl]pyrrole-3-carboxamide (PubChem CID 35245114) has the molecular formula C21H25F3N2O2 and a molecular weight of 394.44 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2,5-dimethyl-N-[(1R,2S)-2-(trifluoromethyl)cyclohexyl]pyrrole-3-carboxamide.
| Compound Name | 1-(4-methoxyphenyl)-2,5-dimethyl-N-[(1R,2S)-2-(trifluoromethyl)cyclohexyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 35245114 |
| Molecular Formula | C21H25F3N2O2 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 1-(4-methoxyphenyl)-2,5-dimethyl-N-[(1R,2S)-2-(trifluoromethyl)cyclohexyl]pyrrole-3-carboxamide |
| SMILES | COc1ccc(-n2c(C)cc(C(=O)N[C@@H]3CCCC[C@@H]3C(F)(F)F)c2C)cc1 |
| InChI | InChI=1S/C21H25F3N2O2/c1-13-12-17(14(2)26(13)15-8-10-16(28-3)11-9-15)20(27)25-19-7-5-4-6-18(19)21(22,23)24/h8-12,18-19H,4-7H2,1-3H3,(H,25,27)/t18-,19+/m0/s1 |
| InChIKey | TUHXNOHOGKPZDW-RBUKOAKNSA-N |
| XLogP | 4.95 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|