About 3-[(4-fluorophenyl)methyl]-6-methoxy-3,4-dihydro-2H-1,3-benzoxazin-3-ium
3-[(4-fluorophenyl)methyl]-6-methoxy-3,4-dihydro-2H-1,3-benzoxazin-3-ium (PubChem CID 3527768) has the molecular formula C16H17FNO2+
and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-6-methoxy-3,4-dihydro-2H-1,3-benzoxazin-3-ium.
Molecular Properties
| Compound Name | 3-[(4-fluorophenyl)methyl]-6-methoxy-3,4-dihydro-2H-1,3-benzoxazin-3-ium |
| PubChem CID | 3527768 |
| Molecular Formula | C16H17FNO2+ |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-6-methoxy-3,4-dihydro-2H-1,3-benzoxazin-3-ium |
| SMILES | COc1ccc2c(c1)C[NH+](Cc1ccc(F)cc1)CO2 |
| InChI | InChI=1S/C16H16FNO2/c1-19-15-6-7-16-13(8-15)10-18(11-20-16)9-12-2-4-14(17)5-3-12/h2-8H,9-11H2,1H3/p+1 |
| InChIKey | BJNLHUWSRDXNEB-UHFFFAOYSA-O |
| XLogP | 1.77 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(4-fluorophenyl)methyl]-6-methoxy-3,4-dihydro-2H-1,3-benzoxazin-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-fluorophenyl)methyl]-6-methoxy-3,4-dihydro-2H-1,3-benzoxazin-3-ium?
The IUPAC name of 3-[(4-fluorophenyl)methyl]-6-methoxy-3,4-dihydro-2H-1,3-benzoxazin-3-ium (CID 3527768) is 3-[(4-fluorophenyl)methyl]-6-methoxy-3,4-dihydro-2H-1,3-benzoxazin-3-ium.
What is the SMILES notation for 3-[(4-fluorophenyl)methyl]-6-methoxy-3,4-dihydro-2H-1,3-benzoxazin-3-ium?
The canonical SMILES for 3-[(4-fluorophenyl)methyl]-6-methoxy-3,4-dihydro-2H-1,3-benzoxazin-3-ium is COc1ccc2c(c1)C[NH+](Cc1ccc(F)cc1)CO2.
What is the InChIKey of 3-[(4-fluorophenyl)methyl]-6-methoxy-3,4-dihydro-2H-1,3-benzoxazin-3-ium?
The InChIKey is BJNLHUWSRDXNEB-UHFFFAOYSA-O. The full InChI is InChI=1S/C16H16FNO2/c1-19-15-6-7-16-13(8-15)10-18(11-20-16)9-12-2-4-14(17)5-3-12/h2-8H,9-11H2,1H3/p+1.
What are the key properties of 3-[(4-fluorophenyl)methyl]-6-methoxy-3,4-dihydro-2H-1,3-benzoxazin-3-ium?
3-[(4-fluorophenyl)methyl]-6-methoxy-3,4-dihydro-2H-1,3-benzoxazin-3-ium has a molecular weight of 274.32 g/mol, XLogP of 1.77, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-fluorophenyl)methyl]-6-methoxy-3,4-dihydro-2H-1,3-benzoxazin-3-ium is sourced from PubChem (CID 3527768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).