C37H52N2O2 — CID 3530551
4-[[(benzylideneamino)-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]amino]methyl]-2,6-ditert-butylphenol (PubChem CID 3530551) has the molecular formula C37H52N2O2 and a molecular weight of 556.84 g/mol. Its IUPAC name is 4-[[(benzylideneamino)-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]amino]methyl]-2,6-ditert-butylphenol.
| Compound Name | 4-[[(benzylideneamino)-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]amino]methyl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 3530551 |
| Molecular Formula | C37H52N2O2 |
| Molecular Weight | 556.84 g/mol |
| Exact Mass | 556.40 |
| IUPAC Name | 4-[[(benzylideneamino)-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]amino]methyl]-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(CN(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)N=Cc2ccccc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C37H52N2O2/c1-34(2,3)28-18-26(19-29(32(28)40)35(4,5)6)23-39(38-22-25-16-14-13-15-17-25)24-27-20-30(36(7,8)9)33(41)31(21-27)37(10,11)12/h13-22,40-41H,23-24H2,1-12H3 |
| InChIKey | CLJGHUPDEDZOQB-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 56.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.84 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|