C18H16BrN3O6 — CID 3536287
methyl 2-[4-bromo-2-[[[2-(2-nitrophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 3536287) has the molecular formula C18H16BrN3O6 and a molecular weight of 450.25 g/mol. Its IUPAC name is methyl 2-[4-bromo-2-[[[2-(2-nitrophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-bromo-2-[[[2-(2-nitrophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 3536287 |
| Molecular Formula | C18H16BrN3O6 |
| Molecular Weight | 450.25 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | methyl 2-[4-bromo-2-[[[2-(2-nitrophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(Br)cc1C=NNC(=O)Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16BrN3O6/c1-27-18(24)11-28-16-7-6-14(19)8-13(16)10-20-21-17(23)9-12-4-2-3-5-15(12)22(25)26/h2-8,10H,9,11H2,1H3,(H,21,23) |
| InChIKey | QJULKIZXSFKQSH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|