C21H18BrFN4O3 — CID 5224706
N-[[1-(4-bromo-2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(2-nitrophenyl)acetamide (PubChem CID 5224706) has the molecular formula C21H18BrFN4O3 and a molecular weight of 473.30 g/mol. Its IUPAC name is N-[[1-(4-bromo-2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(2-nitrophenyl)acetamide.
| Compound Name | N-[[1-(4-bromo-2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 5224706 |
| Molecular Formula | C21H18BrFN4O3 |
| Molecular Weight | 473.30 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | N-[[1-(4-bromo-2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(2-nitrophenyl)acetamide |
| SMILES | Cc1cc(C=NNC(=O)Cc2ccccc2[N+](=O)[O-])c(C)n1-c1ccc(Br)cc1F |
| InChI | InChI=1S/C21H18BrFN4O3/c1-13-9-16(14(2)26(13)20-8-7-17(22)11-18(20)23)12-24-25-21(28)10-15-5-3-4-6-19(15)27(29)30/h3-9,11-12H,10H2,1-2H3,(H,25,28) |
| InChIKey | LHADUCUYBLKBLF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.30 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|