C30H30N4O — CID 3556521
1-(4-butyl-2-phenylimidazo[1,2-a]benzimidazol-1-yl)-3-[4-(dimethylamino)phenyl]prop-2-en-1-one (PubChem CID 3556521) has the molecular formula C30H30N4O and a molecular weight of 462.60 g/mol. Its IUPAC name is 1-(4-butyl-2-phenylimidazo[1,2-a]benzimidazol-1-yl)-3-[4-(dimethylamino)phenyl]prop-2-en-1-one.
| Compound Name | 1-(4-butyl-2-phenylimidazo[1,2-a]benzimidazol-1-yl)-3-[4-(dimethylamino)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 3556521 |
| Molecular Formula | C30H30N4O |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 1-(4-butyl-2-phenylimidazo[1,2-a]benzimidazol-1-yl)-3-[4-(dimethylamino)phenyl]prop-2-en-1-one |
| SMILES | CCCCn1c2ccccc2n2c(C(=O)C=Cc3ccc(N(C)C)cc3)c(-c3ccccc3)nc12 |
| InChI | InChI=1S/C30H30N4O/c1-4-5-21-33-25-13-9-10-14-26(25)34-29(28(31-30(33)34)23-11-7-6-8-12-23)27(35)20-17-22-15-18-24(19-16-22)32(2)3/h6-20H,4-5,21H2,1-3H3 |
| InChIKey | FPTVDJIFALRPTR-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|