C23H22N2O6S — CID 3563140
[4-[[benzyl-(4-methyl-3-nitrobenzoyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 3563140) has the molecular formula C23H22N2O6S and a molecular weight of 454.50 g/mol. Its IUPAC name is [4-[[benzyl-(4-methyl-3-nitrobenzoyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[[benzyl-(4-methyl-3-nitrobenzoyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 3563140 |
| Molecular Formula | C23H22N2O6S |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | [4-[[benzyl-(4-methyl-3-nitrobenzoyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | Cc1ccc(C(=O)N(Cc2ccccc2)Cc2ccc(OS(C)(=O)=O)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H22N2O6S/c1-17-8-11-20(14-22(17)25(27)28)23(26)24(15-18-6-4-3-5-7-18)16-19-9-12-21(13-10-19)31-32(2,29)30/h3-14H,15-16H2,1-2H3 |
| InChIKey | FJKCIIPMDKNEHJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|