C38H43F2NO3 — CID 3578105
(3,4-difluorophenyl)-[5-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone (PubChem CID 3578105) has the molecular formula C38H43F2NO3 and a molecular weight of 599.76 g/mol. Its IUPAC name is (3,4-difluorophenyl)-[5-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone.
| Compound Name | (3,4-difluorophenyl)-[5-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone |
|---|---|
| PubChem CID | 3578105 |
| Molecular Formula | C38H43F2NO3 |
| Molecular Weight | 599.76 g/mol |
| Exact Mass | 599.32 |
| IUPAC Name | (3,4-difluorophenyl)-[5-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN2CCc3ccccc3C2)c2ccc(cc2C(=O)c2ccc(F)c(F)c2)CC(O)CC1 |
| InChI | InChI=1S/C38H43F2NO3/c1-25-6-5-17-37(2)33(15-18-38(37,44)24-41-19-16-27-7-3-4-8-29(27)23-41)31-13-10-26(20-30(42)12-9-25)21-32(31)36(43)28-11-14-34(39)35(40)22-28/h3-4,6-8,10-11,13-14,21-22,30,33,42,44H,5,9,12,15-20,23-24H2,1-2H3 |
| InChIKey | VVTRZFIXUMXLBQ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.76 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|