C22H24N2+2 — CID 3588266
1,4-bis(3-phenylprop-2-ynyl)piperazine-1,4-diium (PubChem CID 3588266) has the molecular formula C22H24N2+2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 1,4-bis(3-phenylprop-2-ynyl)piperazine-1,4-diium.
| Compound Name | 1,4-bis(3-phenylprop-2-ynyl)piperazine-1,4-diium |
|---|---|
| PubChem CID | 3588266 |
| Molecular Formula | C22H24N2+2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1,4-bis(3-phenylprop-2-ynyl)piperazine-1,4-diium |
| SMILES | C(#Cc1ccccc1)C[NH+]1CC[NH+](CC#Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H22N2/c1-3-9-21(10-4-1)13-7-15-23-17-19-24(20-18-23)16-8-14-22-11-5-2-6-12-22/h1-6,9-12H,15-20H2/p+2 |
| InChIKey | XMXLQHNQDBRYPX-UHFFFAOYSA-P |
| XLogP | -0.13 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|