C15H9Br2ClN4O — CID 3589514
2,6-dibromo-4-[[(4-chlorophthalazin-1-yl)hydrazinylidene]methyl]phenol (PubChem CID 3589514) has the molecular formula C15H9Br2ClN4O and a molecular weight of 456.53 g/mol. Its IUPAC name is 2,6-dibromo-4-[[(4-chlorophthalazin-1-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 2,6-dibromo-4-[[(4-chlorophthalazin-1-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 3589514 |
| Molecular Formula | C15H9Br2ClN4O |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 453.88 |
| IUPAC Name | 2,6-dibromo-4-[[(4-chlorophthalazin-1-yl)hydrazinylidene]methyl]phenol |
| SMILES | Oc1c(Br)cc(C=NNc2nnc(Cl)c3ccccc23)cc1Br |
| InChI | InChI=1S/C15H9Br2ClN4O/c16-11-5-8(6-12(17)13(11)23)7-19-21-15-10-4-2-1-3-9(10)14(18)20-22-15/h1-7,23H,(H,21,22) |
| InChIKey | MAHACSIWYGIRBM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|