C16H17ClF3N3O3S2 — CID 3603123
5-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-hydroxyiminoethyl]-N,N-diethylthiophene-2-sulfonamide (PubChem CID 3603123) has the molecular formula C16H17ClF3N3O3S2 and a molecular weight of 455.91 g/mol. Its IUPAC name is 5-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-hydroxyiminoethyl]-N,N-diethylthiophene-2-sulfonamide.
| Compound Name | 5-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-hydroxyiminoethyl]-N,N-diethylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 3603123 |
| Molecular Formula | C16H17ClF3N3O3S2 |
| Molecular Weight | 455.91 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | 5-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-hydroxyiminoethyl]-N,N-diethylthiophene-2-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(C=NO)c2ncc(C(F)(F)F)cc2Cl)s1 |
| InChI | InChI=1S/C16H17ClF3N3O3S2/c1-3-23(4-2)28(25,26)14-6-5-13(27-14)11(9-22-24)15-12(17)7-10(8-21-15)16(18,19)20/h5-9,11,24H,3-4H2,1-2H3 |
| InChIKey | JCVSMRWDQWTWIY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.91 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|