C40H47ClFNO5 — CID 3631300
ethyl N-benzyl-N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]carbamate (PubChem CID 3631300) has the molecular formula C40H47ClFNO5 and a molecular weight of 676.27 g/mol. Its IUPAC name is ethyl N-benzyl-N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]carbamate.
| Compound Name | ethyl N-benzyl-N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]carbamate |
|---|---|
| PubChem CID | 3631300 |
| Molecular Formula | C40H47ClFNO5 |
| Molecular Weight | 676.27 g/mol |
| Exact Mass | 675.31 |
| IUPAC Name | ethyl N-benzyl-N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]carbamate |
| SMILES | CCOC(=O)N(Cc1ccccc1)CC1(O)CCC2C34C=CC5(C=C3C(=O)Cc3c(F)cccc3Cl)CC(O)CCC5(C)C4CCC21C |
| InChI | InChI=1S/C40H47ClFNO5/c1-4-48-35(46)43(24-26-9-6-5-7-10-26)25-39(47)18-15-34-37(39,3)17-14-33-36(2)16-13-27(44)22-38(36)19-20-40(33,34)29(23-38)32(45)21-28-30(41)11-8-12-31(28)42/h5-12,19-20,23,27,33-34,44,47H,4,13-18,21-22,24-25H2,1-3H3 |
| InChIKey | IQYBRMOGXPPNHU-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.27 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|