C10H12F3N3O3S — CID 3654903
methyl 3,3,3-trifluoro-2-(propanoylamino)-2-(1,3-thiazol-2-ylamino)propanoate (PubChem CID 3654903) has the molecular formula C10H12F3N3O3S and a molecular weight of 311.29 g/mol. Its IUPAC name is methyl 3,3,3-trifluoro-2-(propanoylamino)-2-(1,3-thiazol-2-ylamino)propanoate.
| Compound Name | methyl 3,3,3-trifluoro-2-(propanoylamino)-2-(1,3-thiazol-2-ylamino)propanoate |
|---|---|
| PubChem CID | 3654903 |
| Molecular Formula | C10H12F3N3O3S |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | methyl 3,3,3-trifluoro-2-(propanoylamino)-2-(1,3-thiazol-2-ylamino)propanoate |
| SMILES | CCC(=O)NC(Nc1nccs1)(C(=O)OC)C(F)(F)F |
| InChI | InChI=1S/C10H12F3N3O3S/c1-3-6(17)15-9(7(18)19-2,10(11,12)13)16-8-14-4-5-20-8/h4-5H,3H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | GODGBHYZGBEZLT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|