C20H21N5O3S2 — CID 3659525
N-[(3-benzylsulfanyl-5-methyl-1,2,4-triazol-4-yl)carbamothioyl]-3,5-dimethoxybenzamide (PubChem CID 3659525) has the molecular formula C20H21N5O3S2 and a molecular weight of 443.55 g/mol. Its IUPAC name is N-[(3-benzylsulfanyl-5-methyl-1,2,4-triazol-4-yl)carbamothioyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[(3-benzylsulfanyl-5-methyl-1,2,4-triazol-4-yl)carbamothioyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 3659525 |
| Molecular Formula | C20H21N5O3S2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | N-[(3-benzylsulfanyl-5-methyl-1,2,4-triazol-4-yl)carbamothioyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NC(=S)Nn2c(C)nnc2SCc2ccccc2)c1 |
| InChI | InChI=1S/C20H21N5O3S2/c1-13-22-23-20(30-12-14-7-5-4-6-8-14)25(13)24-19(29)21-18(26)15-9-16(27-2)11-17(10-15)28-3/h4-11H,12H2,1-3H3,(H2,21,24,26,29) |
| InChIKey | RIZDPKZOCLGKEA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|