C19H18ClN5OS2 — CID 4647832
N-[(3-benzylsulfanyl-5-methyl-1,2,4-triazol-4-yl)carbamothioyl]-2-(4-chlorophenyl)acetamide (PubChem CID 4647832) has the molecular formula C19H18ClN5OS2 and a molecular weight of 431.97 g/mol. Its IUPAC name is N-[(3-benzylsulfanyl-5-methyl-1,2,4-triazol-4-yl)carbamothioyl]-2-(4-chlorophenyl)acetamide.
| Compound Name | N-[(3-benzylsulfanyl-5-methyl-1,2,4-triazol-4-yl)carbamothioyl]-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 4647832 |
| Molecular Formula | C19H18ClN5OS2 |
| Molecular Weight | 431.97 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | N-[(3-benzylsulfanyl-5-methyl-1,2,4-triazol-4-yl)carbamothioyl]-2-(4-chlorophenyl)acetamide |
| SMILES | Cc1nnc(SCc2ccccc2)n1NC(=S)NC(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18ClN5OS2/c1-13-22-23-19(28-12-15-5-3-2-4-6-15)25(13)24-18(27)21-17(26)11-14-7-9-16(20)10-8-14/h2-10H,11-12H2,1H3,(H2,21,24,26,27) |
| InChIKey | LVZWYNXVWBKZEO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.97 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|