C20H15Cl2N5OS3 — CID 17115831
N-[(3-benzylsulfanyl-5-methyl-1,2,4-triazol-4-yl)carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide (PubChem CID 17115831) has the molecular formula C20H15Cl2N5OS3 and a molecular weight of 508.48 g/mol. Its IUPAC name is N-[(3-benzylsulfanyl-5-methyl-1,2,4-triazol-4-yl)carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(3-benzylsulfanyl-5-methyl-1,2,4-triazol-4-yl)carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17115831 |
| Molecular Formula | C20H15Cl2N5OS3 |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 506.98 |
| IUPAC Name | N-[(3-benzylsulfanyl-5-methyl-1,2,4-triazol-4-yl)carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide |
| SMILES | Cc1nnc(SCc2ccccc2)n1NC(=S)NC(=O)c1sc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C20H15Cl2N5OS3/c1-11-24-25-20(30-10-12-5-3-2-4-6-12)27(11)26-19(29)23-18(28)17-16(22)14-8-7-13(21)9-15(14)31-17/h2-9H,10H2,1H3,(H2,23,26,28,29) |
| InChIKey | IDUOWCQMIQCYLB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|