C24H19Cl2N5O2S2 — CID 17317307
(E)-N-[(3-benzylsulfanyl-5-methyl-1,2,4-triazol-4-yl)carbamothioyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17317307) has the molecular formula C24H19Cl2N5O2S2 and a molecular weight of 544.49 g/mol. Its IUPAC name is (E)-N-[(3-benzylsulfanyl-5-methyl-1,2,4-triazol-4-yl)carbamothioyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[(3-benzylsulfanyl-5-methyl-1,2,4-triazol-4-yl)carbamothioyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17317307 |
| Molecular Formula | C24H19Cl2N5O2S2 |
| Molecular Weight | 544.49 g/mol |
| Exact Mass | 543.04 |
| IUPAC Name | (E)-N-[(3-benzylsulfanyl-5-methyl-1,2,4-triazol-4-yl)carbamothioyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | Cc1nnc(SCc2ccccc2)n1NC(=S)NC(=O)/C=C/c1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C24H19Cl2N5O2S2/c1-15-28-29-24(35-14-16-6-3-2-4-7-16)31(15)30-23(34)27-21(32)13-11-17-10-12-20(33-17)18-8-5-9-19(25)22(18)26/h2-13H,14H2,1H3,(H2,27,30,32,34)/b13-11+ |
| InChIKey | MROJEBOYTIDYSE-ACCUITESSA-N |
| XLogP | 6.10 |
| TPSA | 84.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.49 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|