C23H19Cl2N5O2S2 — CID 17314313
N-[(3-benzylsulfanyl-5-ethyl-1,2,4-triazol-4-yl)carbamothioyl]-5-(2,3-dichlorophenyl)furan-2-carboxamide (PubChem CID 17314313) has the molecular formula C23H19Cl2N5O2S2 and a molecular weight of 532.48 g/mol. Its IUPAC name is N-[(3-benzylsulfanyl-5-ethyl-1,2,4-triazol-4-yl)carbamothioyl]-5-(2,3-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-[(3-benzylsulfanyl-5-ethyl-1,2,4-triazol-4-yl)carbamothioyl]-5-(2,3-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17314313 |
| Molecular Formula | C23H19Cl2N5O2S2 |
| Molecular Weight | 532.48 g/mol |
| Exact Mass | 531.04 |
| IUPAC Name | N-[(3-benzylsulfanyl-5-ethyl-1,2,4-triazol-4-yl)carbamothioyl]-5-(2,3-dichlorophenyl)furan-2-carboxamide |
| SMILES | CCc1nnc(SCc2ccccc2)n1NC(=S)NC(=O)c1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C23H19Cl2N5O2S2/c1-2-19-27-28-23(34-13-14-7-4-3-5-8-14)30(19)29-22(33)26-21(31)18-12-11-17(32-18)15-9-6-10-16(24)20(15)25/h3-12H,2,13H2,1H3,(H2,26,29,31,33) |
| InChIKey | ULEJGBIEECDPDX-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 84.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.48 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|