C21H21FN6O2S — CID 36636052
1-[2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylacetyl]-N-phenylpiperidine-4-carboxamide (PubChem CID 36636052) has the molecular formula C21H21FN6O2S and a molecular weight of 440.50 g/mol. Its IUPAC name is 1-[2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylacetyl]-N-phenylpiperidine-4-carboxamide.
| Compound Name | 1-[2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylacetyl]-N-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 36636052 |
| Molecular Formula | C21H21FN6O2S |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 1-[2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylacetyl]-N-phenylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1CCN(C(=O)CSc2nnnn2-c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C21H21FN6O2S/c22-16-5-4-8-18(13-16)28-21(24-25-26-28)31-14-19(29)27-11-9-15(10-12-27)20(30)23-17-6-2-1-3-7-17/h1-8,13,15H,9-12,14H2,(H,23,30) |
| InChIKey | DRQADRMJYXKVTI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |