C15H18NO2+ — CID 36762206
1-[2-(3,5-dimethylphenoxy)ethyl]pyridin-1-ium-3-ol (PubChem CID 36762206) has the molecular formula C15H18NO2+ and a molecular weight of 244.31 g/mol. Its IUPAC name is 1-[2-(3,5-dimethylphenoxy)ethyl]pyridin-1-ium-3-ol.
| Compound Name | 1-[2-(3,5-dimethylphenoxy)ethyl]pyridin-1-ium-3-ol |
|---|---|
| PubChem CID | 36762206 |
| Molecular Formula | C15H18NO2+ |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 1-[2-(3,5-dimethylphenoxy)ethyl]pyridin-1-ium-3-ol |
| SMILES | Cc1cc(C)cc(OCC[n+]2cccc(O)c2)c1 |
| InChI | InChI=1S/C15H17NO2/c1-12-8-13(2)10-15(9-12)18-7-6-16-5-3-4-14(17)11-16/h3-5,8-11H,6-7H2,1-2H3/p+1 |
| InChIKey | LQAWAGTXSZNJES-UHFFFAOYSA-O |
| XLogP | 2.38 |
| TPSA | 33.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|