C16H11BrF3NO3S2 — CID 3688444
N-(1-benzothiophen-3-ylmethyl)-4-bromo-2-(trifluoromethoxy)benzenesulfonamide (PubChem CID 3688444) has the molecular formula C16H11BrF3NO3S2 and a molecular weight of 466.30 g/mol. Its IUPAC name is N-(1-benzothiophen-3-ylmethyl)-4-bromo-2-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-(1-benzothiophen-3-ylmethyl)-4-bromo-2-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 3688444 |
| Molecular Formula | C16H11BrF3NO3S2 |
| Molecular Weight | 466.30 g/mol |
| Exact Mass | 464.93 |
| IUPAC Name | N-(1-benzothiophen-3-ylmethyl)-4-bromo-2-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(NCc1csc2ccccc12)c1ccc(Br)cc1OC(F)(F)F |
| InChI | InChI=1S/C16H11BrF3NO3S2/c17-11-5-6-15(13(7-11)24-16(18,19)20)26(22,23)21-8-10-9-25-14-4-2-1-3-12(10)14/h1-7,9,21H,8H2 |
| InChIKey | HHOSHQPUKDLTMR-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.30 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |