C33H28Cl2N6O5 — CID 3688581
2-cyano-3-[4-[7-[(2,4-dichlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]oxy-3-methoxyphenyl]-N-(3,4-dimethylphenyl)prop-2-enamide (PubChem CID 3688581) has the molecular formula C33H28Cl2N6O5 and a molecular weight of 659.53 g/mol. Its IUPAC name is 2-cyano-3-[4-[7-[(2,4-dichlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]oxy-3-methoxyphenyl]-N-(3,4-dimethylphenyl)prop-2-enamide.
| Compound Name | 2-cyano-3-[4-[7-[(2,4-dichlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]oxy-3-methoxyphenyl]-N-(3,4-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3688581 |
| Molecular Formula | C33H28Cl2N6O5 |
| Molecular Weight | 659.53 g/mol |
| Exact Mass | 658.15 |
| IUPAC Name | 2-cyano-3-[4-[7-[(2,4-dichlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]oxy-3-methoxyphenyl]-N-(3,4-dimethylphenyl)prop-2-enamide |
| SMILES | COc1cc(C=C(C#N)C(=O)Nc2ccc(C)c(C)c2)ccc1Oc1nc2c(c(=O)n(C)c(=O)n2C)n1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C33H28Cl2N6O5/c1-18-6-10-24(12-19(18)2)37-30(42)22(16-36)13-20-7-11-26(27(14-20)45-5)46-32-38-29-28(31(43)40(4)33(44)39(29)3)41(32)17-21-8-9-23(34)15-25(21)35/h6-15H,17H2,1-5H3,(H,37,42) |
| InChIKey | QZVXFELAGWBQKX-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 133.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.53 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|