C25H25Cl2N7O4S — CID 3349353
1-[[4-[7-[(2,4-dichlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]oxy-3-methoxyphenyl]methylideneamino]-3-ethylthiourea (PubChem CID 3349353) has the molecular formula C25H25Cl2N7O4S and a molecular weight of 590.49 g/mol. Its IUPAC name is 1-[[4-[7-[(2,4-dichlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]oxy-3-methoxyphenyl]methylideneamino]-3-ethylthiourea.
| Compound Name | 1-[[4-[7-[(2,4-dichlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]oxy-3-methoxyphenyl]methylideneamino]-3-ethylthiourea |
|---|---|
| PubChem CID | 3349353 |
| Molecular Formula | C25H25Cl2N7O4S |
| Molecular Weight | 590.49 g/mol |
| Exact Mass | 589.11 |
| IUPAC Name | 1-[[4-[7-[(2,4-dichlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]oxy-3-methoxyphenyl]methylideneamino]-3-ethylthiourea |
| SMILES | CCNC(=S)NN=Cc1ccc(Oc2nc3c(c(=O)n(C)c(=O)n3C)n2Cc2ccc(Cl)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C25H25Cl2N7O4S/c1-5-28-23(39)31-29-12-14-6-9-18(19(10-14)37-4)38-24-30-21-20(22(35)33(3)25(36)32(21)2)34(24)13-15-7-8-16(26)11-17(15)27/h6-12H,5,13H2,1-4H3,(H2,28,31,39) |
| InChIKey | KGYSOZKUIJPYOD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 116.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|