C26H22Cl2N6O5 — CID 3985493
2-cyano-3-[4-[7-[(2,4-dichlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]oxy-3-methoxyphenyl]-N-methylprop-2-enamide (PubChem CID 3985493) has the molecular formula C26H22Cl2N6O5 and a molecular weight of 569.41 g/mol. Its IUPAC name is 2-cyano-3-[4-[7-[(2,4-dichlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]oxy-3-methoxyphenyl]-N-methylprop-2-enamide.
| Compound Name | 2-cyano-3-[4-[7-[(2,4-dichlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]oxy-3-methoxyphenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 3985493 |
| Molecular Formula | C26H22Cl2N6O5 |
| Molecular Weight | 569.41 g/mol |
| Exact Mass | 568.10 |
| IUPAC Name | 2-cyano-3-[4-[7-[(2,4-dichlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]oxy-3-methoxyphenyl]-N-methylprop-2-enamide |
| SMILES | CNC(=O)C(C#N)=Cc1ccc(Oc2nc3c(c(=O)n(C)c(=O)n3C)n2Cc2ccc(Cl)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C26H22Cl2N6O5/c1-30-23(35)16(12-29)9-14-5-8-19(20(10-14)38-4)39-25-31-22-21(24(36)33(3)26(37)32(22)2)34(25)13-15-6-7-17(27)11-18(15)28/h5-11H,13H2,1-4H3,(H,30,35) |
| InChIKey | PCMDOAJMLJDUHM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 133.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|