C30H26Cl2N6O5 — CID 3938521
N-[[4-[7-[(2,4-dichlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]oxy-3-methoxyphenyl]methylideneamino]-3-methylbenzamide (PubChem CID 3938521) has the molecular formula C30H26Cl2N6O5 and a molecular weight of 621.48 g/mol. Its IUPAC name is N-[[4-[7-[(2,4-dichlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]oxy-3-methoxyphenyl]methylideneamino]-3-methylbenzamide.
| Compound Name | N-[[4-[7-[(2,4-dichlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]oxy-3-methoxyphenyl]methylideneamino]-3-methylbenzamide |
|---|---|
| PubChem CID | 3938521 |
| Molecular Formula | C30H26Cl2N6O5 |
| Molecular Weight | 621.48 g/mol |
| Exact Mass | 620.13 |
| IUPAC Name | N-[[4-[7-[(2,4-dichlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]oxy-3-methoxyphenyl]methylideneamino]-3-methylbenzamide |
| SMILES | COc1cc(C=NNC(=O)c2cccc(C)c2)ccc1Oc1nc2c(c(=O)n(C)c(=O)n2C)n1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H26Cl2N6O5/c1-17-6-5-7-19(12-17)27(39)35-33-15-18-8-11-23(24(13-18)42-4)43-29-34-26-25(28(40)37(3)30(41)36(26)2)38(29)16-20-9-10-21(31)14-22(20)32/h5-15H,16H2,1-4H3,(H,35,39) |
| InChIKey | OXYZIBONIBAJSY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 121.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|