C35H33Cl2N11O4 — CID 5018439
8-[4-[[(4-anilino-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]-7-[(2,4-dichlorophenyl)methyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 5018439) has the molecular formula C35H33Cl2N11O4 and a molecular weight of 742.63 g/mol. Its IUPAC name is 8-[4-[[(4-anilino-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]-7-[(2,4-dichlorophenyl)methyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-[4-[[(4-anilino-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]-7-[(2,4-dichlorophenyl)methyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 5018439 |
| Molecular Formula | C35H33Cl2N11O4 |
| Molecular Weight | 742.63 g/mol |
| Exact Mass | 741.21 |
| IUPAC Name | 8-[4-[[(4-anilino-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenoxy]-7-[(2,4-dichlorophenyl)methyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | COc1cc(C=NNc2nc(Nc3ccccc3)nc(N3CCCC3)n2)ccc1Oc1nc2c(c(=O)n(C)c(=O)n2C)n1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C35H33Cl2N11O4/c1-45-29-28(30(49)46(2)35(45)50)48(20-22-12-13-23(36)18-25(22)37)34(40-29)52-26-14-11-21(17-27(26)51-3)19-38-44-32-41-31(39-24-9-5-4-6-10-24)42-33(43-32)47-15-7-8-16-47/h4-6,9-14,17-19H,7-8,15-16,20H2,1-3H3,(H2,39,41,42,43,44) |
| InChIKey | JTIHZQIJKPSFPK-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 158.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.63 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|