C26H21Cl2N5O5S2 — CID 4019480
7-[(2,4-dichlorophenyl)methyl]-8-[2-methoxy-4-[(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-1,3-dimethylpurine-2,6-dione (PubChem CID 4019480) has the molecular formula C26H21Cl2N5O5S2 and a molecular weight of 618.52 g/mol. Its IUPAC name is 7-[(2,4-dichlorophenyl)methyl]-8-[2-methoxy-4-[(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[(2,4-dichlorophenyl)methyl]-8-[2-methoxy-4-[(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 4019480 |
| Molecular Formula | C26H21Cl2N5O5S2 |
| Molecular Weight | 618.52 g/mol |
| Exact Mass | 617.04 |
| IUPAC Name | 7-[(2,4-dichlorophenyl)methyl]-8-[2-methoxy-4-[(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-1,3-dimethylpurine-2,6-dione |
| SMILES | COc1cc(C=C2SC(=S)N(C)C2=O)ccc1Oc1nc2c(c(=O)n(C)c(=O)n2C)n1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H21Cl2N5O5S2/c1-30-21-20(23(35)31(2)25(30)36)33(12-14-6-7-15(27)11-16(14)28)24(29-21)38-17-8-5-13(9-18(17)37-4)10-19-22(34)32(3)26(39)40-19/h5-11H,12H2,1-4H3 |
| InChIKey | NXYVHXOKZOHFGH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 100.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|