C28H28N6O6 — CID 3703731
2-cyano-3-[4-[4-[[2-cyano-3-oxo-3-(propanoylamino)prop-1-enyl]amino]-2-methoxyphenyl]-3-methoxyanilino]-N-propanoylprop-2-enamide (PubChem CID 3703731) has the molecular formula C28H28N6O6 and a molecular weight of 544.57 g/mol. Its IUPAC name is 2-cyano-3-[4-[4-[[2-cyano-3-oxo-3-(propanoylamino)prop-1-enyl]amino]-2-methoxyphenyl]-3-methoxyanilino]-N-propanoylprop-2-enamide.
| Compound Name | 2-cyano-3-[4-[4-[[2-cyano-3-oxo-3-(propanoylamino)prop-1-enyl]amino]-2-methoxyphenyl]-3-methoxyanilino]-N-propanoylprop-2-enamide |
|---|---|
| PubChem CID | 3703731 |
| Molecular Formula | C28H28N6O6 |
| Molecular Weight | 544.57 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | 2-cyano-3-[4-[4-[[2-cyano-3-oxo-3-(propanoylamino)prop-1-enyl]amino]-2-methoxyphenyl]-3-methoxyanilino]-N-propanoylprop-2-enamide |
| SMILES | CCC(=O)NC(=O)C(C#N)=CNc1ccc(-c2ccc(NC=C(C#N)C(=O)NC(=O)CC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C28H28N6O6/c1-5-25(35)33-27(37)17(13-29)15-31-19-7-9-21(23(11-19)39-3)22-10-8-20(12-24(22)40-4)32-16-18(14-30)28(38)34-26(36)6-2/h7-12,15-16,31-32H,5-6H2,1-4H3,(H,33,35,37)(H,34,36,38) |
| InChIKey | NIMTYVYVIXSOPC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 182.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.57 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|