C27H30N6O5 — CID 3721950
N-(2-methoxyphenyl)-2-[2-[3-(3-nitrophenyl)pyrazol-1-yl]acetyl]-2,8-diazaspiro[4.5]decane-8-carboxamide (PubChem CID 3721950) has the molecular formula C27H30N6O5 and a molecular weight of 518.57 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-[2-[3-(3-nitrophenyl)pyrazol-1-yl]acetyl]-2,8-diazaspiro[4.5]decane-8-carboxamide.
| Compound Name | N-(2-methoxyphenyl)-2-[2-[3-(3-nitrophenyl)pyrazol-1-yl]acetyl]-2,8-diazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 3721950 |
| Molecular Formula | C27H30N6O5 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | N-(2-methoxyphenyl)-2-[2-[3-(3-nitrophenyl)pyrazol-1-yl]acetyl]-2,8-diazaspiro[4.5]decane-8-carboxamide |
| SMILES | COc1ccccc1NC(=O)N1CCC2(CCN(C(=O)Cn3ccc(-c4cccc([N+](=O)[O-])c4)n3)C2)CC1 |
| InChI | InChI=1S/C27H30N6O5/c1-38-24-8-3-2-7-23(24)28-26(35)30-14-10-27(11-15-30)12-16-31(19-27)25(34)18-32-13-9-22(29-32)20-5-4-6-21(17-20)33(36)37/h2-9,13,17H,10-12,14-16,18-19H2,1H3,(H,28,35) |
| InChIKey | BTOWWIAFCTTWQP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 122.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|