C23H25N5O5S2 — CID 3838322
2-[3-(3-nitrophenyl)pyrazol-1-yl]-1-(8-thiophen-2-ylsulfonyl-2,8-diazaspiro[4.5]decan-2-yl)ethanone (PubChem CID 3838322) has the molecular formula C23H25N5O5S2 and a molecular weight of 515.62 g/mol. Its IUPAC name is 2-[3-(3-nitrophenyl)pyrazol-1-yl]-1-(8-thiophen-2-ylsulfonyl-2,8-diazaspiro[4.5]decan-2-yl)ethanone.
| Compound Name | 2-[3-(3-nitrophenyl)pyrazol-1-yl]-1-(8-thiophen-2-ylsulfonyl-2,8-diazaspiro[4.5]decan-2-yl)ethanone |
|---|---|
| PubChem CID | 3838322 |
| Molecular Formula | C23H25N5O5S2 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | 2-[3-(3-nitrophenyl)pyrazol-1-yl]-1-(8-thiophen-2-ylsulfonyl-2,8-diazaspiro[4.5]decan-2-yl)ethanone |
| SMILES | O=C(Cn1ccc(-c2cccc([N+](=O)[O-])c2)n1)N1CCC2(CCN(S(=O)(=O)c3cccs3)CC2)C1 |
| InChI | InChI=1S/C23H25N5O5S2/c29-21(16-26-10-6-20(24-26)18-3-1-4-19(15-18)28(30)31)25-11-7-23(17-25)8-12-27(13-9-23)35(32,33)22-5-2-14-34-22/h1-6,10,14-15H,7-9,11-13,16-17H2 |
| InChIKey | XYCWAWHNOOLBGH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 118.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|