C20H26N2O3S2 — CID 4995125
(2-methylcyclohexa-2,5-dien-1-yl)-(8-thiophen-2-ylsulfonyl-2,8-diazaspiro[4.5]decan-2-yl)methanone (PubChem CID 4995125) has the molecular formula C20H26N2O3S2 and a molecular weight of 406.57 g/mol. Its IUPAC name is (2-methylcyclohexa-2,5-dien-1-yl)-(8-thiophen-2-ylsulfonyl-2,8-diazaspiro[4.5]decan-2-yl)methanone.
| Compound Name | (2-methylcyclohexa-2,5-dien-1-yl)-(8-thiophen-2-ylsulfonyl-2,8-diazaspiro[4.5]decan-2-yl)methanone |
|---|---|
| PubChem CID | 4995125 |
| Molecular Formula | C20H26N2O3S2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | (2-methylcyclohexa-2,5-dien-1-yl)-(8-thiophen-2-ylsulfonyl-2,8-diazaspiro[4.5]decan-2-yl)methanone |
| SMILES | CC1=CCC=CC1C(=O)N1CCC2(CCN(S(=O)(=O)c3cccs3)CC2)C1 |
| InChI | InChI=1S/C20H26N2O3S2/c1-16-5-2-3-6-17(16)19(23)21-11-8-20(15-21)9-12-22(13-10-20)27(24,25)18-7-4-14-26-18/h3-7,14,17H,2,8-13,15H2,1H3 |
| InChIKey | LXMGXCMMFZOGAN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|