C21H14BrClN2OS — CID 3729495
N-(4-bromophenyl)-1-[2-[(2-chloro-1,3-thiazol-5-yl)methoxy]naphthalen-1-yl]methanimine (PubChem CID 3729495) has the molecular formula C21H14BrClN2OS and a molecular weight of 457.78 g/mol. Its IUPAC name is N-(4-bromophenyl)-1-[2-[(2-chloro-1,3-thiazol-5-yl)methoxy]naphthalen-1-yl]methanimine.
| Compound Name | N-(4-bromophenyl)-1-[2-[(2-chloro-1,3-thiazol-5-yl)methoxy]naphthalen-1-yl]methanimine |
|---|---|
| PubChem CID | 3729495 |
| Molecular Formula | C21H14BrClN2OS |
| Molecular Weight | 457.78 g/mol |
| Exact Mass | 455.97 |
| IUPAC Name | N-(4-bromophenyl)-1-[2-[(2-chloro-1,3-thiazol-5-yl)methoxy]naphthalen-1-yl]methanimine |
| SMILES | Clc1ncc(COc2ccc3ccccc3c2/C=N/c2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C21H14BrClN2OS/c22-15-6-8-16(9-7-15)24-12-19-18-4-2-1-3-14(18)5-10-20(19)26-13-17-11-25-21(23)27-17/h1-12H,13H2/b24-12+ |
| InChIKey | HPLTZCISPCEZGI-WYMPLXKRSA-N |
| XLogP | 7.04 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.78 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|