About 3-(phenoxymethyl)benzoic acid
3-(phenoxymethyl)benzoic acid (PubChem CID 3729884) has the molecular formula C14H12O3
and a molecular weight of 228.25 g/mol. Its IUPAC name is 3-(phenoxymethyl)benzoic acid.
Molecular Properties
| Compound Name | 3-(phenoxymethyl)benzoic acid |
| PubChem CID | 3729884 |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 3-(phenoxymethyl)benzoic acid |
| SMILES | O=C(O)c1cccc(COc2ccccc2)c1 |
| InChI | InChI=1S/C14H12O3/c15-14(16)12-6-4-5-11(9-12)10-17-13-7-2-1-3-8-13/h1-9H,10H2,(H,15,16) |
| InChIKey | URLYREZIPSJJQU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(phenoxymethyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(phenoxymethyl)benzoic acid?
The IUPAC name of 3-(phenoxymethyl)benzoic acid (CID 3729884) is 3-(phenoxymethyl)benzoic acid.
What is the SMILES notation for 3-(phenoxymethyl)benzoic acid?
The canonical SMILES for 3-(phenoxymethyl)benzoic acid is O=C(O)c1cccc(COc2ccccc2)c1.
What is the InChIKey of 3-(phenoxymethyl)benzoic acid?
The InChIKey is URLYREZIPSJJQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O3/c15-14(16)12-6-4-5-11(9-12)10-17-13-7-2-1-3-8-13/h1-9H,10H2,(H,15,16).
What are the key properties of 3-(phenoxymethyl)benzoic acid?
3-(phenoxymethyl)benzoic acid has a molecular weight of 228.25 g/mol, XLogP of 2.96, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(phenoxymethyl)benzoic acid is sourced from PubChem (CID 3729884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).