C20H23NO3S — CID 37400540
N-(4-cyclopentylsulfanylphenyl)-2,3-dimethoxybenzamide (PubChem CID 37400540) has the molecular formula C20H23NO3S and a molecular weight of 357.48 g/mol. Its IUPAC name is N-(4-cyclopentylsulfanylphenyl)-2,3-dimethoxybenzamide.
| Compound Name | N-(4-cyclopentylsulfanylphenyl)-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 37400540 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | N-(4-cyclopentylsulfanylphenyl)-2,3-dimethoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(SC3CCCC3)cc2)c1OC |
| InChI | InChI=1S/C20H23NO3S/c1-23-18-9-5-8-17(19(18)24-2)20(22)21-14-10-12-16(13-11-14)25-15-6-3-4-7-15/h5,8-13,15H,3-4,6-7H2,1-2H3,(H,21,22) |
| InChIKey | BMSZLUWTXYDMRX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |