C20H19FN4S — CID 3747167
1-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methylideneamino]-3-prop-2-enylthiourea (PubChem CID 3747167) has the molecular formula C20H19FN4S and a molecular weight of 366.47 g/mol. Its IUPAC name is 1-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methylideneamino]-3-prop-2-enylthiourea.
| Compound Name | 1-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methylideneamino]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 3747167 |
| Molecular Formula | C20H19FN4S |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 1-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methylideneamino]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NN=Cc1cn(Cc2ccccc2F)c2ccccc12 |
| InChI | InChI=1S/C20H19FN4S/c1-2-11-22-20(26)24-23-12-16-14-25(19-10-6-4-8-17(16)19)13-15-7-3-5-9-18(15)21/h2-10,12,14H,1,11,13H2,(H2,22,24,26) |
| InChIKey | AEKHVTIAXUIHEJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|